CAS 2260763-86-6 is the registry number for 2,2''-Dibromo-5'-(2-bromo-5-fluorophenyl)-5,5''-difluoro-1,1':3',1''-terphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,3,5-tris(2-bromo-5-fluorophenyl)benzene (CAS 2260763-86-6) is a chemical compound with the molecular formula C24H12Br3F3 and a molecular weight of 597.1 g/mol. IUPAC name: 1,3,5-tris(2-bromo-5-fluorophenyl)benzene. InChIKey: JPBANYBSEIFBCR-UHFFFAOYSA-N.
| Molecular formula | C24H12Br3F3 |
|---|---|
| Molecular weight | 597.1 g/mol |
| IUPAC name | 1,3,5-tris(2-bromo-5-fluorophenyl)benzene |
| InChIKey | JPBANYBSEIFBCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C2=CC(=CC(=C2)C3=C(C=CC(=C3)F)Br)C4=C(C=CC(=C4)F)Br)Br |
Computed by PubChem (NCBI)