CAS 2178101-68-1 appears in our catalog under these names: 2,2''-DIBROMO-5'-(2-BROMO-4-FLUOROPHENYL)-4,4''-DIFLUORO-1,1':3',1''-TERPHENYL, 95%, 95%, 2,2''-Dibromo-5'-(2-bromo-4-fluorophenyl)-4,4''-difluoro-1,1':3',1''-terphenyl, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,3,5-tris(2-bromo-4-fluorophenyl)benzene (CAS 2178101-68-1) is a chemical compound with the molecular formula C24H12Br3F3 and a molecular weight of 597.1 g/mol. IUPAC name: 1,3,5-tris(2-bromo-4-fluorophenyl)benzene. InChIKey: IPRLFSDKHOEQQU-UHFFFAOYSA-N.
| Molecular formula | C24H12Br3F3 |
|---|---|
| Molecular weight | 597.1 g/mol |
| IUPAC name | 1,3,5-tris(2-bromo-4-fluorophenyl)benzene |
| InChIKey | IPRLFSDKHOEQQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)C2=CC(=CC(=C2)C3=C(C=C(C=C3)F)Br)C4=C(C=C(C=C4)F)Br |
Computed by PubChem (NCBI)