Products 2260914-35-8
CAS 2260914-35-8 is the registry number for 2,5-Bis((R)-2-hydroxypropoxy)terephthalohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-bis[(2R)-2-hydroxypropoxy]benzene-1,4-dicarbohydrazide (CAS 2260914-35-8) is a chemical compound with the molecular formula C14H22N4O6 and a molecular weight of 342.35 g/mol. IUPAC name: 2,5-bis[(2R)-2-hydroxypropoxy]benzene-1,4-dicarbohydrazide. InChIKey: RQZKOTHYQDJIFG-HTQZYQBOSA-N.
| Molecular formula | C14H22N4O6 |
|---|---|
| Molecular weight | 342.35 g/mol |
| IUPAC name | 2,5-bis[(2R)-2-hydroxypropoxy]benzene-1,4-dicarbohydrazide |
| InChIKey | RQZKOTHYQDJIFG-HTQZYQBOSA-N |
| SMILES | C[C@H](COC1=CC(=C(C=C1C(=O)NN)OC[C@@H](C)O)C(=O)NN)O |
Computed by PubChem (NCBI)