Products 2260931-97-1

CAS 2260931-97-1 is the registry number for tert-Butyl 4-(5-amino-1H-1,2,3,4-tetrazol-1-yl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(5-aminotetrazol-1-yl)piperidine-1-carboxylate (CAS 2260931-97-1) is a chemical compound with the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. IUPAC name: tert-butyl 4-(5-aminotetrazol-1-yl)piperidine-1-carboxylate. InChIKey: QMFQFOVAMDVTRL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20N6O2
Molecular weight268.32 g/mol
IUPAC nametert-butyl 4-(5-aminotetrazol-1-yl)piperidine-1-carboxylate
InChIKeyQMFQFOVAMDVTRL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)N2C(=NN=N2)N

Computed by PubChem (NCBI)