CAS 2260933-03-5 is the registry number for Methyl 5-fluoro-1h-1,3-benzodiazole-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.
Methyl 6-fluoro-1H-benzimidazole-2-carboxylate;hydrochloride (CAS 2260933-03-5) is a chemical compound with the molecular formula C9H8ClFN2O2 and a molecular weight of 230.62 g/mol. IUPAC name: methyl 6-fluoro-1H-benzimidazole-2-carboxylate;hydrochloride. InChIKey: SNNPLLJMPNGMST-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFN2O2 |
|---|---|
| Molecular weight | 230.62 g/mol |
| IUPAC name | methyl 6-fluoro-1H-benzimidazole-2-carboxylate;hydrochloride |
| InChIKey | SNNPLLJMPNGMST-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(N1)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)