Products 2260933-03-5

CAS 2260933-03-5 is the registry number for Methyl 5-fluoro-1h-1,3-benzodiazole-2-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

Methyl 6-fluoro-1H-benzimidazole-2-carboxylate;hydrochloride (CAS 2260933-03-5) is a chemical compound with the molecular formula C9H8ClFN2O2 and a molecular weight of 230.62 g/mol. IUPAC name: methyl 6-fluoro-1H-benzimidazole-2-carboxylate;hydrochloride. InChIKey: SNNPLLJMPNGMST-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClFN2O2
Molecular weight230.62 g/mol
IUPAC namemethyl 6-fluoro-1H-benzimidazole-2-carboxylate;hydrochloride
InChIKeySNNPLLJMPNGMST-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC2=C(N1)C=C(C=C2)F.Cl

Computed by PubChem (NCBI)