CAS 2260936-05-6 is the registry number for 1-Methanesulfonyl-3,3-dimethylbutan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,3-dimethyl-1-methylsulfonylbutan-2-amine;hydrochloride (CAS 2260936-05-6) is a chemical compound with the molecular formula C7H18ClNO2S and a molecular weight of 215.74 g/mol. IUPAC name: 3,3-dimethyl-1-methylsulfonylbutan-2-amine;hydrochloride. InChIKey: PGKXRWCEYWGMDP-UHFFFAOYSA-N.
| Molecular formula | C7H18ClNO2S |
|---|---|
| Molecular weight | 215.74 g/mol |
| IUPAC name | 3,3-dimethyl-1-methylsulfonylbutan-2-amine;hydrochloride |
| InChIKey | PGKXRWCEYWGMDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CS(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)