Products 2260969-37-5
CAS 2260969-37-5 is the registry number for Selnoflast (monopotassium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Potassium (1-ethylpiperidin-4-yl)sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide (CAS 2260969-37-5) is a chemical compound with the molecular formula C20H28KN3O3S and a molecular weight of 429.6 g/mol. IUPAC name: potassium (1-ethylpiperidin-4-yl)sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide. InChIKey: MKLRQXHTYFRPSC-UHFFFAOYSA-M.
| Molecular formula | C20H28KN3O3S |
|---|---|
| Molecular weight | 429.6 g/mol |
| IUPAC name | potassium (1-ethylpiperidin-4-yl)sulfonyl-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)azanide |
| InChIKey | MKLRQXHTYFRPSC-UHFFFAOYSA-M |
| SMILES | CCN1CCC(CC1)S(=O)(=O)[N-]C(=O)NC2=C3CCCC3=CC4=C2CCC4.[K+] |
Computed by PubChem (NCBI)