CAS 2261-99-6 appears in our catalog under these names: 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl methacrylate, 98% (stabilized with TBC), 2,2,3,3,4,4,5,5,6,6,7,7–Dodecafluoroheptyl Methacrylate (stabilized with TBC), 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl Methacrylate (stabilized with TBC), >97.0%(GC), 1H,1H,7H-Dodecafluoroheptyl methacrylate, 95%. Offered by: AmBeed, GLPBio, TCI, Fluorochem. Available pack sizes: 5g, 100g, 25g, 500g.
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-methylprop-2-enoate (CAS 2261-99-6) is a chemical compound with the molecular formula C11H8F12O2 and a molecular weight of 400.16 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-methylprop-2-enoate. InChIKey: YJKHMSPWWGBKTN-UHFFFAOYSA-N.
| Molecular formula | C11H8F12O2 |
|---|---|
| Molecular weight | 400.16 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl 2-methylprop-2-enoate |
| InChIKey | YJKHMSPWWGBKTN-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)