Products 2262402-83-3
CAS 2262402-83-3 is the registry number for S1P2 antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-2-[4-[[6-chloro-5-(cyclopropylmethoxy)indazol-2-yl]methyl]-1-oxophthalazin-2-yl]propanoic acid (CAS 2262402-83-3) is a chemical compound with the molecular formula C23H21ClN4O4 and a molecular weight of 452.9 g/mol. IUPAC name: (2R)-2-[4-[[6-chloro-5-(cyclopropylmethoxy)indazol-2-yl]methyl]-1-oxophthalazin-2-yl]propanoic acid. InChIKey: PMFUQAVMFHEJFO-CYBMUJFWSA-N.
| Molecular formula | C23H21ClN4O4 |
|---|---|
| Molecular weight | 452.9 g/mol |
| IUPAC name | (2R)-2-[4-[[6-chloro-5-(cyclopropylmethoxy)indazol-2-yl]methyl]-1-oxophthalazin-2-yl]propanoic acid |
| InChIKey | PMFUQAVMFHEJFO-CYBMUJFWSA-N |
| SMILES | C[C@H](C(=O)O)N1C(=O)C2=CC=CC=C2C(=N1)CN3C=C4C=C(C(=CC4=N3)Cl)OCC5CC5 |
Computed by PubChem (NCBI)
Synonyms:
S1P2 antagonist 1, orb1691048