Products 2262405-70-7
CAS 2262405-70-7 is the registry number for 5-Bromo-4-chloro-N,N-bis(4-methoxybenzyl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-chloro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine (CAS 2262405-70-7) is a chemical compound with the molecular formula C21H20BrClN2O2 and a molecular weight of 447.8 g/mol. IUPAC name: 5-bromo-4-chloro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine. InChIKey: BBJWZIHXGQUURD-UHFFFAOYSA-N.
| Molecular formula | C21H20BrClN2O2 |
|---|---|
| Molecular weight | 447.8 g/mol |
| IUPAC name | 5-bromo-4-chloro-N,N-bis[(4-methoxyphenyl)methyl]pyridin-2-amine |
| InChIKey | BBJWZIHXGQUURD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN(CC2=CC=C(C=C2)OC)C3=NC=C(C(=C3)Cl)Br |
Computed by PubChem (NCBI)