CAS 226398-50-1 is the registry number for 4-(4-Fluoro-benzenesulfonyl)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Fluorochem. Available pack sizes: 500mg.
Tert-butyl 4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate (CAS 226398-50-1) is a chemical compound with the molecular formula C16H22FNO4S and a molecular weight of 343.4 g/mol. IUPAC name: tert-butyl 4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate. InChIKey: QQEOFGKCYHRZIQ-UHFFFAOYSA-N.
| Molecular formula | C16H22FNO4S |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | tert-butyl 4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate |
| InChIKey | QQEOFGKCYHRZIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)S(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)