Products 226398-50-1

CAS 226398-50-1 is the registry number for 4-(4-Fluoro-benzenesulfonyl)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Fluorochem. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate (CAS 226398-50-1) is a chemical compound with the molecular formula C16H22FNO4S and a molecular weight of 343.4 g/mol. IUPAC name: tert-butyl 4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate. InChIKey: QQEOFGKCYHRZIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22FNO4S
Molecular weight343.4 g/mol
IUPAC nametert-butyl 4-(4-fluorophenyl)sulfonylpiperidine-1-carboxylate
InChIKeyQQEOFGKCYHRZIQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)S(=O)(=O)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)