CAS 2264-00-8 appears in our catalog under these names: 1H,1H,5H-Octafluoropentyl p-toluenesulfonate, 95%, 1H,1H,5H–Octafluoropentyl p–toluenesulfonate, 2,2,3,3,4,4,5,5-Octafluoropentyl 4-methylbenzenesulfonate, 95%, 95%, 2,2,3,3,4,4,5,5-Octafluoropentyl 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g.
2,2,3,3,4,4,5,5-octafluoropentyl 4-methylbenzenesulfonate (CAS 2264-00-8) is a chemical compound with the molecular formula C12H10F8O3S and a molecular weight of 386.26 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluoropentyl 4-methylbenzenesulfonate. InChIKey: ACPMGBQCNGPAAY-UHFFFAOYSA-N.
| Molecular formula | C12H10F8O3S |
|---|---|
| Molecular weight | 386.26 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluoropentyl 4-methylbenzenesulfonate |
| InChIKey | ACPMGBQCNGPAAY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C(C(C(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)