CAS 2264-25-7 appears in our catalog under these names: Sodium 7H-perfluoroheptanoate, Sodium 7H-perfluoroheptanoate, ≥97%, ≥97%. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 5MG, 1g, 5g, 25g.
Sodium 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate (CAS 2264-25-7) is a chemical compound with the molecular formula C7HF12NaO2 and a molecular weight of 368.05 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate. InChIKey: SZWOFFNEMGRGMA-UHFFFAOYSA-M.
| Molecular formula | C7HF12NaO2 |
|---|---|
| Molecular weight | 368.05 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate |
| InChIKey | SZWOFFNEMGRGMA-UHFFFAOYSA-M |
| SMILES | C(C(C(C(C(C(C(=O)[O-])(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)