CAS 2265236-82-4 appears in our catalog under these names: 1,3-Phenylenedimethanamine dihydrobromide, 98%, Poly(9,9-di(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with N,N-bis(4-methylphenyl)aniline. Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
[3-(aminomethyl)phenyl]methanamine;dihydrobromide (CAS 2265236-82-4) is a chemical compound with the molecular formula C8H14Br2N2 and a molecular weight of 298.02 g/mol. IUPAC name: [3-(aminomethyl)phenyl]methanamine;dihydrobromide. InChIKey: ZJDXVTXTKVXSMJ-UHFFFAOYSA-N.
| Molecular formula | C8H14Br2N2 |
|---|---|
| Molecular weight | 298.02 g/mol |
| IUPAC name | [3-(aminomethyl)phenyl]methanamine;dihydrobromide |
| InChIKey | ZJDXVTXTKVXSMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)CN)CN.Br.Br |
Computed by PubChem (NCBI)