CAS 226548-45-4 is the registry number for 3,5-Bis(trifluoromethyl)cyclohexanamine hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3,5-bis(trifluoromethyl)cyclohexan-1-amine;hydrochloride (CAS 226548-45-4) is a chemical compound with the molecular formula C8H12ClF6N and a molecular weight of 271.63 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)cyclohexan-1-amine;hydrochloride. InChIKey: ALBRWXRKTICYFK-UHFFFAOYSA-N.
| Molecular formula | C8H12ClF6N |
|---|---|
| Molecular weight | 271.63 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)cyclohexan-1-amine;hydrochloride |
| InChIKey | ALBRWXRKTICYFK-UHFFFAOYSA-N |
| SMILES | C1C(CC(CC1C(F)(F)F)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)