CAS 2265919-19-3 is the registry number for 2-Bromo-1-fluoro-3-[(trimethylsilyl)oxy]benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg.
(2-bromo-3-fluorophenoxy)-trimethylsilane (CAS 2265919-19-3) is a chemical compound with the molecular formula C9H12BrFOSi and a molecular weight of 263.18 g/mol. IUPAC name: (2-bromo-3-fluorophenoxy)-trimethylsilane. InChIKey: ZLPSHHLLHBDHQY-UHFFFAOYSA-N.
| Molecular formula | C9H12BrFOSi |
|---|---|
| Molecular weight | 263.18 g/mol |
| IUPAC name | (2-bromo-3-fluorophenoxy)-trimethylsilane |
| InChIKey | ZLPSHHLLHBDHQY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=C(C(=CC=C1)F)Br |
Computed by PubChem (NCBI)