CAS 226714-40-5 is the registry number for Pyrimidine, 5,5',5''-(1,3,5-benzenetriyl)tris-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[3,5-di(pyrimidin-5-yl)phenyl]pyrimidine (CAS 226714-40-5) is a chemical compound with the molecular formula C18H12N6 and a molecular weight of 312.3 g/mol. IUPAC name: 5-[3,5-di(pyrimidin-5-yl)phenyl]pyrimidine. InChIKey: KEWJQPKSAWYDNQ-UHFFFAOYSA-N.
| Molecular formula | C18H12N6 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 5-[3,5-di(pyrimidin-5-yl)phenyl]pyrimidine |
| InChIKey | KEWJQPKSAWYDNQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C2=CN=CN=C2)C3=CN=CN=C3)C4=CN=CN=C4 |
Computed by PubChem (NCBI)