CAS 226717-28-8 appears in our catalog under these names: 1,2-Dimethyl-6-(thiophen-2-yl)-1H-imidazo[4,5-g]quinoxaline, 98%, AGL 2043. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
1,2-dimethyl-6-thiophen-2-ylimidazo[4,5-g]quinoxaline (CAS 226717-28-8) is a chemical compound with the molecular formula C15H12N4S and a molecular weight of 280.3 g/mol. IUPAC name: 1,2-dimethyl-6-thiophen-2-ylimidazo[4,5-g]quinoxaline. InChIKey: ZGDACLBJJXLKJY-UHFFFAOYSA-N.
| Molecular formula | C15H12N4S |
|---|---|
| Molecular weight | 280.3 g/mol |
| IUPAC name | 1,2-dimethyl-6-thiophen-2-ylimidazo[4,5-g]quinoxaline |
| InChIKey | ZGDACLBJJXLKJY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C=C3C(=C2)N=C(C=N3)C4=CC=CS4 |
Computed by PubChem (NCBI)