Products 22672-43-1
CAS 22672-43-1 is the registry number for 1,2-Di-O-acetyl-3,5-di-O-benzoyl-3-beta-C-methyl-D-ribofuranose. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4R)-4,5-diacetyloxy-3-benzoyloxy-3-methyloxolan-2-yl]methyl benzoate (CAS 22672-43-1) is a chemical compound with the molecular formula C24H24O9 and a molecular weight of 456.4 g/mol. IUPAC name: [(2R,3R,4R)-4,5-diacetyloxy-3-benzoyloxy-3-methyloxolan-2-yl]methyl benzoate. InChIKey: PYHAGHQSRVMREB-HDNOUQGDSA-N.
| Molecular formula | C24H24O9 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | [(2R,3R,4R)-4,5-diacetyloxy-3-benzoyloxy-3-methyloxolan-2-yl]methyl benzoate |
| InChIKey | PYHAGHQSRVMREB-HDNOUQGDSA-N |
| SMILES | CC(=O)O[C@H]1C(O[C@@H]([C@@]1(C)OC(=O)C2=CC=CC=C2)COC(=O)C3=CC=CC=C3)OC(=O)C |
Computed by PubChem (NCBI)