CAS 2268-44-2 is the registry number for 1,1,2,2-Tetrachlorotetrafluoropropane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1,1,2,2-tetrachloro-1,3,3,3-tetrafluoropropane (CAS 2268-44-2) is a chemical compound with the molecular formula C3Cl4F4 and a molecular weight of 253.8 g/mol. IUPAC name: 1,1,2,2-tetrachloro-1,3,3,3-tetrafluoropropane. InChIKey: VOEBBCDMYRPKRD-UHFFFAOYSA-N.
| Molecular formula | C3Cl4F4 |
|---|---|
| Molecular weight | 253.8 g/mol |
| IUPAC name | 1,1,2,2-tetrachloro-1,3,3,3-tetrafluoropropane |
| InChIKey | VOEBBCDMYRPKRD-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(Cl)Cl)(Cl)Cl |
Computed by PubChem (NCBI)