CAS 2268004-60-8 is the registry number for 2-Benzhydryl-5'-chloro-1H,1'H-3,3'-biindole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzhydryl-3-(5-chloro-1H-indol-3-yl)-1H-indole (CAS 2268004-60-8) is a chemical compound with the molecular formula C29H21ClN2 and a molecular weight of 432.9 g/mol. IUPAC name: 2-benzhydryl-3-(5-chloro-1H-indol-3-yl)-1H-indole. InChIKey: IZAVFPGNECVRDU-UHFFFAOYSA-N.
| Molecular formula | C29H21ClN2 |
|---|---|
| Molecular weight | 432.9 g/mol |
| IUPAC name | 2-benzhydryl-3-(5-chloro-1H-indol-3-yl)-1H-indole |
| InChIKey | IZAVFPGNECVRDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=C(C4=CC=CC=C4N3)C5=CNC6=C5C=C(C=C6)Cl |
Computed by PubChem (NCBI)