CAS 2268720-62-1 appears in our catalog under these names: URAT1 inhibitor 1, URAT1 inhibitor 1, 99+%, URAT1 inhibitor 1, 97.08%, URAT1 inhibitor 1, 97.08%, 97.08%. Offered by: GLPBio, AmBeed, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 100mg, 50 mg, 5 mg, 25 mg, 10mM/1mL, 100 mg.
1-[[5-bromo-4-[(4-bromonaphthalen-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-3-ylmethanesulfonamide (CAS 2268720-62-1) is a chemical compound with the molecular formula C19H15Br2N5O2S2 and a molecular weight of 569.3 g/mol. IUPAC name: 1-[[5-bromo-4-[(4-bromonaphthalen-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-3-ylmethanesulfonamide. InChIKey: KPBJDNPRRPXSOG-UHFFFAOYSA-N.
| Molecular formula | C19H15Br2N5O2S2 |
|---|---|
| Molecular weight | 569.3 g/mol |
| IUPAC name | 1-[[5-bromo-4-[(4-bromonaphthalen-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-3-ylmethanesulfonamide |
| InChIKey | KPBJDNPRRPXSOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)CN3C(=NN=C3Br)SCS(=O)(=O)NC4=CN=CC=C4 |
Computed by PubChem (NCBI)