Products 2268802-59-9
CAS 2268802-59-9 appears in our catalog under these names: Safinamide Impurity 13, Safinamide Impurity 3, KETO SAFINAMIDE. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 25MG.
N-[(2S)-1-amino-1-oxopropan-2-yl]-4-[(3-fluorophenyl)methoxy]benzamide (CAS 2268802-59-9) is a chemical compound with the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxopropan-2-yl]-4-[(3-fluorophenyl)methoxy]benzamide. InChIKey: XAEYXMOQCYOXLA-NSHDSACASA-N.
| Molecular formula | C17H17FN2O3 |
|---|---|
| Molecular weight | 316.33 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxopropan-2-yl]-4-[(3-fluorophenyl)methoxy]benzamide |
| InChIKey | XAEYXMOQCYOXLA-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)N)NC(=O)C1=CC=C(C=C1)OCC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)