CAS 226986-04-5 is the registry number for (alphaS)-alpha-Amino-2'-(phosphonomethyl)-(1,1'-biphenyl)-3-propanoic Acid. Offered by: TRC. Available pack sizes: 50mg.
(2S)-2-amino-3-[3-[2-(phosphonomethyl)phenyl]phenyl]propanoic acid (CAS 226986-04-5) is a chemical compound with the molecular formula C16H18NO5P and a molecular weight of 335.29 g/mol. IUPAC name: (2S)-2-amino-3-[3-[2-(phosphonomethyl)phenyl]phenyl]propanoic acid. InChIKey: NCEGJIHRQBRVJQ-HNNXBMFYSA-N.
| Molecular formula | C16H18NO5P |
|---|---|
| Molecular weight | 335.29 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-[2-(phosphonomethyl)phenyl]phenyl]propanoic acid |
| InChIKey | NCEGJIHRQBRVJQ-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C(=C1)CP(=O)(O)O)C2=CC=CC(=C2)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)