CAS 227-56-5 is the registry number for Anthra(2,1-b)thiophene. Offered by: TRC. Available pack sizes: 100mg.
Naphtho[2,3-e][1]benzothiole (CAS 227-56-5) is a chemical compound with the molecular formula C16H10S and a molecular weight of 234.3 g/mol. IUPAC name: naphtho[2,3-e][1]benzothiole. InChIKey: PAYSBLPSJQBEJR-UHFFFAOYSA-N.
| Molecular formula | C16H10S |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | naphtho[2,3-e][1]benzothiole |
| InChIKey | PAYSBLPSJQBEJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CC4=C3C=CS4 |
Computed by PubChem (NCBI)