CAS 2270171-49-6 is the registry number for 5-(4-((3,5-Dicarboxyphenoxy)methyl)-1H-1,2,3-triazol-1-yl)isophthalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
5-[4-[(3,5-dicarboxyphenoxy)methyl]triazol-1-yl]benzene-1,3-dicarboxylic acid (CAS 2270171-49-6) is a chemical compound with the molecular formula C19H13N3O9 and a molecular weight of 427.3 g/mol. IUPAC name: 5-[4-[(3,5-dicarboxyphenoxy)methyl]triazol-1-yl]benzene-1,3-dicarboxylic acid. InChIKey: JFTPWADYBYDXAY-UHFFFAOYSA-N.
| Molecular formula | C19H13N3O9 |
|---|---|
| Molecular weight | 427.3 g/mol |
| IUPAC name | 5-[4-[(3,5-dicarboxyphenoxy)methyl]triazol-1-yl]benzene-1,3-dicarboxylic acid |
| InChIKey | JFTPWADYBYDXAY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)N2C=C(N=N2)COC3=CC(=CC(=C3)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)