CAS 2270245-27-5 is the registry number for Safinamide Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl-hydroxyamino]propanamide (CAS 2270245-27-5) is a chemical compound with the molecular formula C17H19FN2O3 and a molecular weight of 318.34 g/mol. IUPAC name: (2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl-hydroxyamino]propanamide. InChIKey: NOTBHJKBTVNPOM-LBPRGKRZSA-N.
| Molecular formula | C17H19FN2O3 |
|---|---|
| Molecular weight | 318.34 g/mol |
| IUPAC name | (2S)-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl-hydroxyamino]propanamide |
| InChIKey | NOTBHJKBTVNPOM-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)N)N(CC1=CC=C(C=C1)OCC2=CC(=CC=C2)F)O |
Computed by PubChem (NCBI)