Products 2270875-79-9
CAS 2270875-79-9 is the registry number for SMARCA2-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(5-amino-2-chloro-4-pyridinyl)-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea (CAS 2270875-79-9) is a chemical compound with the molecular formula C10H8ClF2N5OS and a molecular weight of 319.72 g/mol. IUPAC name: 1-(5-amino-2-chloro-4-pyridinyl)-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea. InChIKey: BHNVQLOUIWHYIX-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF2N5OS |
|---|---|
| Molecular weight | 319.72 g/mol |
| IUPAC name | 1-(5-amino-2-chloro-4-pyridinyl)-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea |
| InChIKey | BHNVQLOUIWHYIX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)N)NC(=O)NC2=CC(=NS2)C(F)F |
Computed by PubChem (NCBI)