CAS 2270879-43-9 is the registry number for SMARCA2-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-chloro-5-(hydroxymethyl)-4-pyridinyl]-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea (CAS 2270879-43-9) is a chemical compound with the molecular formula C11H9ClF2N4O2S and a molecular weight of 334.73 g/mol. IUPAC name: 1-[2-chloro-5-(hydroxymethyl)-4-pyridinyl]-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea. InChIKey: AVHFGSYJGSZHIC-UHFFFAOYSA-N.
| Molecular formula | C11H9ClF2N4O2S |
|---|---|
| Molecular weight | 334.73 g/mol |
| IUPAC name | 1-[2-chloro-5-(hydroxymethyl)-4-pyridinyl]-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea |
| InChIKey | AVHFGSYJGSZHIC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)CO)NC(=O)NC2=CC(=NS2)C(F)F |
Computed by PubChem (NCBI)