CAS 2270905-03-6 is the registry number for 1-(2,3-Difluoro-benzyl)-3,5-dimethyl-1h-pyrazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(2,3-difluorophenyl)methyl]-3,5-dimethylpyrazol-4-ol (CAS 2270905-03-6) is a chemical compound with the molecular formula C12H12F2N2O and a molecular weight of 238.23 g/mol. IUPAC name: 1-[(2,3-difluorophenyl)methyl]-3,5-dimethylpyrazol-4-ol. InChIKey: YZMKMYGCKOYMTF-UHFFFAOYSA-N.
| Molecular formula | C12H12F2N2O |
|---|---|
| Molecular weight | 238.23 g/mol |
| IUPAC name | 1-[(2,3-difluorophenyl)methyl]-3,5-dimethylpyrazol-4-ol |
| InChIKey | YZMKMYGCKOYMTF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=C(C(=CC=C2)F)F)C)O |
Computed by PubChem (NCBI)