CAS 2270905-68-3 is the registry number for C-[5-Bromo-2-(2,2,2-trifluoro-ethoxy)-phenyl]-c-phenyl-methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]-phenylmethanamine (CAS 2270905-68-3) is a chemical compound with the molecular formula C15H13BrF3NO and a molecular weight of 360.17 g/mol. IUPAC name: [5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]-phenylmethanamine. InChIKey: LNHPGOKMXFTHLD-UHFFFAOYSA-N.
| Molecular formula | C15H13BrF3NO |
|---|---|
| Molecular weight | 360.17 g/mol |
| IUPAC name | [5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]-phenylmethanamine |
| InChIKey | LNHPGOKMXFTHLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=CC(=C2)Br)OCC(F)(F)F)N |
Computed by PubChem (NCBI)