CAS 2270906-43-7 is the registry number for 2-(3-Amino-1H-1,2,4-triazol-5-yl)phenol nitrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 25g, 5g, 1g.
2-(3-amino-1H-1,2,4-triazol-5-yl)phenol;nitric acid (CAS 2270906-43-7) is a chemical compound with the molecular formula C8H9N5O4 and a molecular weight of 239.19 g/mol. IUPAC name: 2-(3-amino-1H-1,2,4-triazol-5-yl)phenol;nitric acid. InChIKey: OXDRGZXEAWVRIO-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O4 |
|---|---|
| Molecular weight | 239.19 g/mol |
| IUPAC name | 2-(3-amino-1H-1,2,4-triazol-5-yl)phenol;nitric acid |
| InChIKey | OXDRGZXEAWVRIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)N)O.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)