Products 2270906-43-7

CAS 2270906-43-7 is the registry number for 2-(3-Amino-1H-1,2,4-triazol-5-yl)phenol nitrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3-amino-1H-1,2,4-triazol-5-yl)phenol;nitric acid (CAS 2270906-43-7) is a chemical compound with the molecular formula C8H9N5O4 and a molecular weight of 239.19 g/mol. IUPAC name: 2-(3-amino-1H-1,2,4-triazol-5-yl)phenol;nitric acid. InChIKey: OXDRGZXEAWVRIO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9N5O4
Molecular weight239.19 g/mol
IUPAC name2-(3-amino-1H-1,2,4-triazol-5-yl)phenol;nitric acid
InChIKeyOXDRGZXEAWVRIO-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=NC(=NN2)N)O.[N+](=O)(O)[O-]

Computed by PubChem (NCBI)