CAS 2270906-73-3 is the registry number for 2-Methyl-2-[4-(2,2,2-trifluoro-ethoxy)-pyrazol-1-yl]-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-2-[4-(2,2,2-trifluoroethoxy)pyrazol-1-yl]propanoic acid (CAS 2270906-73-3) is a chemical compound with the molecular formula C9H11F3N2O3 and a molecular weight of 252.19 g/mol. IUPAC name: 2-methyl-2-[4-(2,2,2-trifluoroethoxy)pyrazol-1-yl]propanoic acid. InChIKey: JWXIWTOEBFFAGW-UHFFFAOYSA-N.
| Molecular formula | C9H11F3N2O3 |
|---|---|
| Molecular weight | 252.19 g/mol |
| IUPAC name | 2-methyl-2-[4-(2,2,2-trifluoroethoxy)pyrazol-1-yl]propanoic acid |
| InChIKey | JWXIWTOEBFFAGW-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)N1C=C(C=N1)OCC(F)(F)F |
Computed by PubChem (NCBI)