Products 2270907-84-9

CAS 2270907-84-9 is the registry number for [4-(4-Carbamoyl-3-fluoro-phenyl)-piperazin-1-yl]-acetic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.

Structural formula: {0} (CAS {1})

Benzyl 2-[4-(4-carbamoyl-3-fluorophenyl)piperazin-1-yl]acetate (CAS 2270907-84-9) is a chemical compound with the molecular formula C20H22FN3O3 and a molecular weight of 371.4 g/mol. IUPAC name: benzyl 2-[4-(4-carbamoyl-3-fluorophenyl)piperazin-1-yl]acetate. InChIKey: GPSGGWPTDJDJFN-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22FN3O3
Molecular weight371.4 g/mol
IUPAC namebenzyl 2-[4-(4-carbamoyl-3-fluorophenyl)piperazin-1-yl]acetate
InChIKeyGPSGGWPTDJDJFN-UHFFFAOYSA-N
SMILESC1CN(CCN1CC(=O)OCC2=CC=CC=C2)C3=CC(=C(C=C3)C(=O)N)F

Computed by PubChem (NCBI)