CAS 2270908-15-9 is the registry number for 4-[4-(1-Carboxy-ethoxy)-2-fluoro-phenyl]-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[3-fluoro-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenoxy]propanoic acid (CAS 2270908-15-9) is a chemical compound with the molecular formula C19H26FNO5 and a molecular weight of 367.4 g/mol. IUPAC name: 2-[3-fluoro-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenoxy]propanoic acid. InChIKey: VVYYXRWSZGZXBN-UHFFFAOYSA-N.
| Molecular formula | C19H26FNO5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 2-[3-fluoro-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenoxy]propanoic acid |
| InChIKey | VVYYXRWSZGZXBN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC(=C(C=C1)C2CCN(CC2)C(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)