CAS 2270909-64-1 appears in our catalog under these names: 2-(2-Methoxy-5-nitrophenoxy)ethanamine hydrochloride, 95%, 2-(2-Methoxy-5-nitrophenoxy)ethan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-(2-methoxy-5-nitrophenoxy)ethanamine;hydrochloride (CAS 2270909-64-1) is a chemical compound with the molecular formula C9H13ClN2O4 and a molecular weight of 248.66 g/mol. IUPAC name: 2-(2-methoxy-5-nitrophenoxy)ethanamine;hydrochloride. InChIKey: IEMPONYBZMAZSG-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O4 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 2-(2-methoxy-5-nitrophenoxy)ethanamine;hydrochloride |
| InChIKey | IEMPONYBZMAZSG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])OCCN.Cl |
Computed by PubChem (NCBI)