CAS 2270909-86-7 is the registry number for 3-[1-(2,2,2-Trifluoro-ethyl)-1h-pyrazol-4-yl]-benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]benzaldehyde (CAS 2270909-86-7) is a chemical compound with the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. IUPAC name: 3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]benzaldehyde. InChIKey: SBUHSUNUXWAIMG-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | 3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]benzaldehyde |
| InChIKey | SBUHSUNUXWAIMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CN(N=C2)CC(F)(F)F)C=O |
Computed by PubChem (NCBI)