Products 2270912-39-3
CAS 2270912-39-3 is the registry number for 3-(Dimethylamino)-5-(4-fluoro-3-methoxyphenyl)isoxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(dimethylamino)-5-(4-fluoro-3-methoxyphenyl)-1,2-oxazole-4-carboxylic acid (CAS 2270912-39-3) is a chemical compound with the molecular formula C13H13FN2O4 and a molecular weight of 280.25 g/mol. IUPAC name: 3-(dimethylamino)-5-(4-fluoro-3-methoxyphenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: MEJNLKZFCLDLGF-UHFFFAOYSA-N.
| Molecular formula | C13H13FN2O4 |
|---|---|
| Molecular weight | 280.25 g/mol |
| IUPAC name | 3-(dimethylamino)-5-(4-fluoro-3-methoxyphenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | MEJNLKZFCLDLGF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NOC(=C1C(=O)O)C2=CC(=C(C=C2)F)OC |
Computed by PubChem (NCBI)