Products 2270913-43-2

CAS 2270913-43-2 is the registry number for 3-(3-Iodo-phenoxymethyl)-azetidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Tert-butyl 3-[(3-iodophenoxy)methyl]azetidine-1-carboxylate (CAS 2270913-43-2) is a chemical compound with the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. IUPAC name: tert-butyl 3-[(3-iodophenoxy)methyl]azetidine-1-carboxylate. InChIKey: JTOFAUDFJCBZKS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20INO3
Molecular weight389.23 g/mol
IUPAC nametert-butyl 3-[(3-iodophenoxy)methyl]azetidine-1-carboxylate
InChIKeyJTOFAUDFJCBZKS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(C1)COC2=CC(=CC=C2)I

Computed by PubChem (NCBI)