CAS 2270913-61-4 is the registry number for 1-(6-Azido-hexyloxy)-2-bromo-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(6-azidohexoxy)-2-bromobenzene (CAS 2270913-61-4) is a chemical compound with the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. IUPAC name: 1-(6-azidohexoxy)-2-bromobenzene. InChIKey: ZYICABFYSISHHT-UHFFFAOYSA-N.
| Molecular formula | C12H16BrN3O |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | 1-(6-azidohexoxy)-2-bromobenzene |
| InChIKey | ZYICABFYSISHHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCCCCCCN=[N+]=[N-])Br |
Computed by PubChem (NCBI)