CAS 2270918-29-9 is the registry number for (R)-(1,2,3,4-Tetrahydro-naphthalen-1-yl)-urea, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]urea (CAS 2270918-29-9) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: [(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]urea. InChIKey: PLSFSIDDNZKALV-SNVBAGLBSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | [(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| InChIKey | PLSFSIDDNZKALV-SNVBAGLBSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2C1)NC(=O)N |
Computed by PubChem (NCBI)