CAS 2270942-71-5 is the registry number for Methyl (S)-6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (6S)-6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate (CAS 2270942-71-5) is a chemical compound with the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. IUPAC name: methyl (6S)-6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate. InChIKey: RDZDERLUWVEPBO-LURJTMIESA-N.
| Molecular formula | C9H13N3O2 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | methyl (6S)-6-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate |
| InChIKey | RDZDERLUWVEPBO-LURJTMIESA-N |
| SMILES | C[C@H]1CN2C=NC(=C2CN1)C(=O)OC |
Computed by PubChem (NCBI)