Products 2270947-36-7
CAS 2270947-36-7 is the registry number for Antiviral agent 27. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,3R,5R,7S)-N-(4-aminocyclohexyl)-3-methyl-5-phenyladamantane-1-carboxamide (CAS 2270947-36-7) is a chemical compound with the molecular formula C24H34N2O and a molecular weight of 366.5 g/mol. IUPAC name: (1S,3R,5R,7S)-N-(4-aminocyclohexyl)-3-methyl-5-phenyladamantane-1-carboxamide. InChIKey: TZNRCHUCVIMHIH-NYNXKCSLSA-N.
| Molecular formula | C24H34N2O |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | (1S,3R,5R,7S)-N-(4-aminocyclohexyl)-3-methyl-5-phenyladamantane-1-carboxamide |
| InChIKey | TZNRCHUCVIMHIH-NYNXKCSLSA-N |
| SMILES | C[C@@]12C[C@H]3C[C@@](C1)(C[C@](C3)(C2)C(=O)NC4CCC(CC4)N)C5=CC=CC=C5 |
Computed by PubChem (NCBI)
Synonyms:
orb1941774, KHG