CAS 22713-35-5 is the registry number for 1,3-Dimethyl-1H-benzo(d)(1,2,3)triazol-3-ium iodide, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
1,3-dimethylbenzotriazol-3-ium iodide (CAS 22713-35-5) is a chemical compound with the molecular formula C8H10IN3 and a molecular weight of 275.09 g/mol. IUPAC name: 1,3-dimethylbenzotriazol-3-ium iodide. InChIKey: PREKKAGLNLTYPX-UHFFFAOYSA-M.
| Molecular formula | C8H10IN3 |
|---|---|
| Molecular weight | 275.09 g/mol |
| IUPAC name | 1,3-dimethylbenzotriazol-3-ium iodide |
| InChIKey | PREKKAGLNLTYPX-UHFFFAOYSA-M |
| SMILES | CN1C2=CC=CC=C2[N+](=N1)C.[I-] |
Computed by PubChem (NCBI)