CAS 22715-46-4 is the registry number for Sodium 5h-octafluoropentanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
Sodium 2,2,3,3,4,4,5,5-octafluoropentanoate (CAS 22715-46-4) is a chemical compound with the molecular formula C5HF8NaO2 and a molecular weight of 268.04 g/mol. IUPAC name: sodium 2,2,3,3,4,4,5,5-octafluoropentanoate. InChIKey: WCSVPEMHXPQFCC-UHFFFAOYSA-M.
| Molecular formula | C5HF8NaO2 |
|---|---|
| Molecular weight | 268.04 g/mol |
| IUPAC name | sodium 2,2,3,3,4,4,5,5-octafluoropentanoate |
| InChIKey | WCSVPEMHXPQFCC-UHFFFAOYSA-M |
| SMILES | C(C(C(C(C(=O)[O-])(F)F)(F)F)(F)F)(F)F.[Na+] |
Computed by PubChem (NCBI)