CAS 227202-21-3 appears in our catalog under these names: 6-fluoro-4-oxochromene-3-carbonitrile, 98%, 6-Fluoro-4-oxo-4H-chromene-3-carbonitrile, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
6-fluoro-4-oxochromene-3-carbonitrile (CAS 227202-21-3) is a chemical compound with the molecular formula C10H4FNO2 and a molecular weight of 189.14 g/mol. IUPAC name: 6-fluoro-4-oxochromene-3-carbonitrile. InChIKey: FUKHLJHJAQNLJO-UHFFFAOYSA-N.
| Molecular formula | C10H4FNO2 |
|---|---|
| Molecular weight | 189.14 g/mol |
| IUPAC name | 6-fluoro-4-oxochromene-3-carbonitrile |
| InChIKey | FUKHLJHJAQNLJO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)C(=CO2)C#N |
Computed by PubChem (NCBI)