CAS 2273-51-0 appears in our catalog under these names: Diphenyltin oxide, 95%, Diphenyltin oxide, 98%, DIPHENYLTIN OXIDE, 97%. Offered by: Combi-blocks, AmBeed, Sigma-Aldrich. Available pack sizes: 25g, 1g, 5g.
Oxo(diphenyl)tin (CAS 2273-51-0) is a chemical compound with the molecular formula C12H10OSn and a molecular weight of 288.92 g/mol. IUPAC name: oxo(diphenyl)tin. InChIKey: VPPWQRIBARKZNY-UHFFFAOYSA-N.
| Molecular formula | C12H10OSn |
|---|---|
| Molecular weight | 288.92 g/mol |
| IUPAC name | oxo(diphenyl)tin |
| InChIKey | VPPWQRIBARKZNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Sn](=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)