Products 2274804-89-4
CAS 2274804-89-4 is the registry number for (2S,3S)-tert-Butyl 3-amino-2-(3-bromo-2-fluorobenzyl)pyrrolidine-1-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,3S)-3-amino-2-[(3-bromo-2-fluorophenyl)methyl]pyrrolidine-1-carboxylate (CAS 2274804-89-4) is a chemical compound with the molecular formula C16H22BrFN2O2 and a molecular weight of 373.26 g/mol. IUPAC name: tert-butyl (2S,3S)-3-amino-2-[(3-bromo-2-fluorophenyl)methyl]pyrrolidine-1-carboxylate. InChIKey: IOVHPIVFYMHWBX-STQMWFEESA-N.
| Molecular formula | C16H22BrFN2O2 |
|---|---|
| Molecular weight | 373.26 g/mol |
| IUPAC name | tert-butyl (2S,3S)-3-amino-2-[(3-bromo-2-fluorophenyl)methyl]pyrrolidine-1-carboxylate |
| InChIKey | IOVHPIVFYMHWBX-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H]1CC2=C(C(=CC=C2)Br)F)N |
Computed by PubChem (NCBI)