Products 227607-43-4

CAS 227607-43-4 appears in our catalog under these names: 3,3-Difluoro-1-methylcyclobutanecarboxylic acid, 95%, 3,3-Difluoro-1-methylcyclobutanecarboxylic acid, 3,3-Difluoro-1-methylcyclobutanecarboxylic acid 97%, 3,3-Difluoro-1-methylcyclobutanecarboxylic Acid, 97%, 97%, 3,3-DIFLUORO-1-METHYLCYCLOBUTANECARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 250mg, 1g, 0,25g, 100mg.

Structural formula: {0} (CAS {1})

3,3-difluoro-1-methylcyclobutane-1-carboxylic acid (CAS 227607-43-4) is a chemical compound with the molecular formula C6H8F2O2 and a molecular weight of 150.12 g/mol. IUPAC name: 3,3-difluoro-1-methylcyclobutane-1-carboxylic acid. InChIKey: IBUYIDRQPFGVIL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8F2O2
Molecular weight150.12 g/mol
IUPAC name3,3-difluoro-1-methylcyclobutane-1-carboxylic acid
InChIKeyIBUYIDRQPFGVIL-UHFFFAOYSA-N
SMILESCC1(CC(C1)(F)F)C(=O)O

Computed by PubChem (NCBI)