CAS 2277480-01-8 is the registry number for 2,6-dibromo-4-chlorobenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,6-dibromo-4-chlorobenzamide (CAS 2277480-01-8) is a chemical compound with the molecular formula C7H4Br2ClNO and a molecular weight of 313.37 g/mol. IUPAC name: 2,6-dibromo-4-chlorobenzamide. InChIKey: DWZSFGPDDRWALL-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2ClNO |
|---|---|
| Molecular weight | 313.37 g/mol |
| IUPAC name | 2,6-dibromo-4-chlorobenzamide |
| InChIKey | DWZSFGPDDRWALL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)C(=O)N)Br)Cl |
Computed by PubChem (NCBI)